19659-00-8 Usage
General Description
DL-LEU-DL-TYR is a combination of two amino acids, DL-leucine and DL-tyrosine. DL-leucine is a branched-chain amino acid that is essential for protein synthesis and muscle growth, making it popular among athletes and bodybuilders. It also plays a role in regulating blood sugar levels and providing energy to the muscles. DL-tyrosine is a non-essential amino acid that is involved in the production of neurotransmitters such as dopamine, norepinephrine, and epinephrine, which are important for mood regulation and stress response. Together, DL-LEU-DL-TYR provides a combination of essential and non-essential amino acids that support muscle growth, energy production, and mental well-being.
Check Digit Verification of cas no
The CAS Registry Mumber 19659-00-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,6,5 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19659-00:
(7*1)+(6*9)+(5*6)+(4*5)+(3*9)+(2*0)+(1*0)=138
138 % 10 = 8
So 19659-00-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H22N2O4/c1-9(2)7-12(16)14(19)17-13(15(20)21)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8,16H2,1-2H3,(H,17,19)(H,20,21)/t12-,13-/m0/s1
