19721-24-5 Usage
Description
1,4,5-triamino-2,3-dichloro-8-hydroxyanthraquinone is a hydroxyanthraquinone derivative with a complex structure containing multiple functional groups. It has a backbone of anthraquinone with an attached hydroxy group, and it also contains two chlorine atoms and three amino groups, which give it strong potential for interactions with other molecules. Its aromatic structure and ability to form complex structures with metal ions make it a subject of interest for researchers and scientists in various industries.
Uses
Used in Dye and Pigment Chemistry:
1,4,5-triamino-2,3-dichloro-8-hydroxyanthraquinone is used as a dye and pigment in the chemical industry for its aromatic structure and ability to form complex structures with metal ions. Its specific properties and reactivity make it a promising candidate for the development of new dyes and pigments with unique color characteristics and improved performance.
Used in Research and Development:
1,4,5-triamino-2,3-dichloro-8-hydroxyanthraquinone is used as a research compound in various scientific fields, including chemistry, materials science, and pharmaceuticals. Its unique structure and reactivity make it a valuable tool for studying molecular interactions, developing new synthetic methods, and exploring potential applications in various industries.
Used in Pharmaceutical Industry:
1,4,5-triamino-2,3-dichloro-8-hydroxyanthraquinone is used as a pharmaceutical intermediate or a potential drug candidate in the pharmaceutical industry. Its complex structure and functional groups may offer opportunities for the development of new therapeutic agents with novel mechanisms of action or improved pharmacological properties.
Used in Environmental Applications:
1,4,5-triamino-2,3-dichloro-8-hydroxyanthraquinone may be used in environmental applications, such as water treatment or pollution control, due to its ability to form complexes with metal ions. This property could potentially be harnessed to remove heavy metals or other contaminants from water or soil, contributing to environmental protection and remediation efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 19721-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,2 and 1 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19721-24:
(7*1)+(6*9)+(5*7)+(4*2)+(3*1)+(2*2)+(1*4)=115
115 % 10 = 5
So 19721-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H9Cl2N3O3/c15-9-10(16)12(19)8-7(11(9)18)13(21)5-3(17)1-2-4(20)6(5)14(8)22/h1-2,20H,17-19H2
