19977-14-1 Usage
General Description
1-Piperazinecarboxylic acid, 4-(2-benzoyloxy-3-(1,3-dimethyl-7-xanthinyl)propyl)-, ethylester is a chemical compound with the molecular formula C28H30N4O6. It is a derivative of piperazine, a cyclic amine, and is commonly used in the pharmaceutical industry. 1-Piperazinecarboxylic acid, 4-(2-benzoyloxy-3-(1,3-dimethyl-7-xanthin yl)propyl)-, ethylester has potential therapeutic applications due to its ability to interact with xanthine receptors, which are involved in various physiological processes. The ethyl ester form of the compound allows for improved stability and solubility, making it a suitable candidate for drug development and research.
Check Digit Verification of cas no
The CAS Registry Mumber 19977-14-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,7 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19977-14:
(7*1)+(6*9)+(5*9)+(4*7)+(3*7)+(2*1)+(1*4)=161
161 % 10 = 1
So 19977-14-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N6O6/c1-4-35-24(34)29-12-10-28(11-13-29)14-18(36-22(32)17-8-6-5-7-9-17)15-30-16-25-20-19(30)21(31)27(3)23(33)26(20)2/h5-9,16,18H,4,10-15H2,1-3H3