399043-24-4 Usage
General Description
2-Amino-3-(4-bromobenzoyl)thiophene, also known as ABT, is a chemical compound with the molecular formula C10H8BrNOS. It is a derivative of thiophene that contains a bromobenzoyl substituent at the 3-position and an amino group at the 2-position. 2-AMINO-3-(4-BROMOBENZOYL)THIOPHENE has potential applications in pharmaceutical and agrochemical industries due to its unique structure and diverse biological activities. It is commonly used as a building block for the synthesis of various pharmaceutical products and research chemicals. Additionally, it has shown promising activities against certain cancer cell lines and has been studied for its potential as an anticancer agent. Overall, 2-amino-3-(4-bromobenzoyl)thiophene is a versatile compound with potential applications in various fields of chemistry and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 399043-24-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,9,9,0,4 and 3 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 399043-24:
(8*3)+(7*9)+(6*9)+(5*0)+(4*4)+(3*3)+(2*2)+(1*4)=174
174 % 10 = 4
So 399043-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H8BrNOS/c12-8-3-1-7(2-4-8)10(14)9-5-6-15-11(9)13/h1-6H,13H2