499207-38-4 Usage
General Description
3-Pyrrolidin-2-yl-quinoline is a chemical compound that belongs to the quinoline class and contains a pyrrolidine ring. It has potential applications in medicinal chemistry due to its ability to interact with biological targets such as receptors and enzymes. 3-Pyrrolidin-2-yl-quinoline has been studied for its potential pharmacological properties, including its antimalarial and anti-cancer activities. 3-PYRROLIDIN-2-YL-QUINOLINE has also been investigated for its potential as a scaffolding molecule in drug discovery and development. Its unique structure and potential for biological activity make it an interesting target for further research and development of new pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 499207-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,9,2,0 and 7 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 499207-38:
(8*4)+(7*9)+(6*9)+(5*2)+(4*0)+(3*7)+(2*3)+(1*8)=194
194 % 10 = 4
So 499207-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2/c1-2-5-12-10(4-1)8-11(9-15-12)13-6-3-7-14-13/h1-2,4-5,8-9,13-14H,3,6-7H2