69902-04-1 Usage
General Description
"2-([(Benzyloxy)carbonyl]amino)-2-(4-chlorophenyl)acetic acid" is a complex organic chemical compound that belongs to the class of chemicals known as phenylacetic acid derivatives. It contains a phenylacetic acid moiety, which is simply a benzene ring substituted with a carboxylic acid group and one other functional group. It is often prepared using 4-chlorophenylglycine and is used in the synthesis of other complex compounds. 2-([(BENZYLOXY)CARBONYL]AMINO)-2-(4-CHLOROPHENYL)ACETIC ACID can be seen in benzyl ester form and is typically involved in various chemical reactions that involve carbonyl groups or carboxyl groups. It can act as a reagent, a protecting group, or a linker in the synthesis of other compounds. Specific preparation, reaction conditions, and use for this basic compound widely depend on the specific context and overall synthetic strategy. As being an organic chemical, it needs to be handled properly due to possible health and environmental hazards. The information including physical-chemical properties, stability, and reactivity, toxicology, ecological, disposal considerations of "2-([(Benzyloxy)carbonyl]amino)-2-(4-chlorophenyl)acetic acid," is usually provided by the material safety data sheet (MSDS) by the supplier.
Check Digit Verification of cas no
The CAS Registry Mumber 69902-04-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,9,9,0 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 69902-04:
(7*6)+(6*9)+(5*9)+(4*0)+(3*2)+(2*0)+(1*4)=151
151 % 10 = 1
So 69902-04-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H14ClNO4/c17-13-8-6-12(7-9-13)14(15(19)20)18-16(21)22-10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H,18,21)(H,19,20)/p-1/t14-/m1/s1
