799283-92-4 Usage
General Description
1-(5-Bromopyrimidin-2-yl)piperidine-4-carboxylic acid is a chemical compound with the molecular formula C12H14BrN3O2. It is a piperidine derivative containing a bromopyrimidine moiety and a carboxylic acid group. 1-(5-BROMOPYRIMIDIN-2-YL)PIPERIDINE-4-CARBOXYLIC ACID is used in organic synthesis and medicinal chemistry as a building block for the preparation of various biologically active molecules. Its chemical structure makes it a potential candidate for developing pharmaceuticals targeting specific biological targets, particularly in the field of drug discovery and development. The compound's unique structure and reactivity make it valuable for research purposes, especially in the development of new drug candidates with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 799283-92-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,9,9,2,8 and 3 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 799283-92:
(8*7)+(7*9)+(6*9)+(5*2)+(4*8)+(3*3)+(2*9)+(1*2)=244
244 % 10 = 4
So 799283-92-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BrN3O2/c11-8-5-12-10(13-6-8)14-3-1-7(2-4-14)9(15)16/h5-7H,1-4H2,(H,15,16)
