101-45-1 Usage
Description
2-[benzyl(1-methyl-2-phenoxyethyl)amino]ethanol is an organic compound with a complex molecular structure that features a benzyl group, a 1-methyl-2-phenoxyethyl group, and an amino group attached to an ethanol backbone. 2-[benzyl(1-methyl-2-phenoxyethyl)amino]ethanol is characterized by its unique chemical properties and potential applications in various industries.
Uses
Used in Pharmaceutical Industry:
2-[benzyl(1-methyl-2-phenoxyethyl)amino]ethanol is used as an active pharmaceutical ingredient for the development of medications targeting various medical conditions. Its unique molecular structure allows it to interact with specific biological targets, making it a promising candidate for the treatment of certain diseases.
Used in Chemical Synthesis:
In the field of chemical synthesis, 2-[benzyl(1-methyl-2-phenoxyethyl)amino]ethanol serves as a key intermediate or building block for the synthesis of more complex molecules with specific applications. Its versatile structure enables it to be used in the creation of a wide range of compounds, including pharmaceuticals, agrochemicals, and specialty chemicals.
Used in Research and Development:
2-[benzyl(1-methyl-2-phenoxyethyl)amino]ethanol is also utilized in research and development laboratories for the study of its chemical properties, reactivity, and potential applications. Researchers can use this compound to explore new reaction pathways, develop novel synthetic methods, and investigate its biological activities.
Used in Drug Delivery Systems:
Similar to gallotannin, 2-[benzyl(1-methyl-2-phenoxyethyl)amino]ethanol can be employed in the development of drug delivery systems to improve the bioavailability and therapeutic outcomes of various medications. Its unique structure allows for the design of targeted drug delivery systems that can enhance the efficacy of drugs and reduce side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 101-45-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 1 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 101-45:
(5*1)+(4*0)+(3*1)+(2*4)+(1*5)=21
21 % 10 = 1
So 101-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H23NO2/c1-16(15-21-18-10-6-3-7-11-18)19(12-13-20)14-17-8-4-2-5-9-17/h2-11,16,20H,12-15H2,1H3
