101420-67-1 Usage
General Description
4-methyl-5-nitro-1H-indazole is a chemical compound with the molecular formula C8H7N3O2. It is a member of the indazole family, which is a class of heterocyclic compounds containing a ring structure composed of carbon and nitrogen atoms. This particular compound is characterized by the presence of a methyl group and a nitro group on the indazole ring. It is commonly used in the production of pharmaceuticals and agrochemicals due to its versatile chemical properties and potential for various applications in drug discovery and development. Additionally, 4-methyl-5-nitro-1H-indazole has been studied for its potential biological activities and pharmacological effects, further highlighting its significance in the field of medicinal chemistry and drug research.
Check Digit Verification of cas no
The CAS Registry Mumber 101420-67-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,4,2 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 101420-67:
(8*1)+(7*0)+(6*1)+(5*4)+(4*2)+(3*0)+(2*6)+(1*7)=61
61 % 10 = 1
So 101420-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2/c1-5-6-4-9-10-7(6)2-3-8(5)11(12)13/h2-4H,1H3,(H,9,10)
