103141-09-9 Usage
General Description
FPL 62064 is a synthetic chemical compound that is used as a pesticide and insecticide. It is a neonicotinoid, which means that it acts on the central nervous system of insects by binding to specific receptors and disrupting their normal function. FPL 62064 is known for its strong toxic effects on a wide range of insect pests, making it effective for controlling agricultural and household pests. However, it has also been associated with harmful effects on non-target organisms, including bees and other pollinators, leading to concerns about its impact on the environment and ecosystems. As a result, its use is regulated in some regions to minimize potential risks to non-target species.
Check Digit Verification of cas no
The CAS Registry Mumber 103141-09-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,1,4 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 103141-09:
(8*1)+(7*0)+(6*3)+(5*1)+(4*4)+(3*1)+(2*0)+(1*9)=59
59 % 10 = 9
So 103141-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H15N3O/c1-20-15-9-7-13(8-10-15)17-16-11-12-19(18-16)14-5-3-2-4-6-14/h2-12H,1H3,(H,17,18)
