103404-89-3 Usage
General Description
5-HYDROXY-DL-TRYPTOPHAN ETHYL ESTER HYDROCHLORIDE is a chemical compound that is a derivative of the amino acid tryptophan. It is commonly used as a precursor in the synthesis of serotonin, a neurotransmitter that plays a key role in regulating mood, appetite, and sleep. 5-HYDROXY-DL-TRYPTOPHAN ETHYL ESTER HYDROCHLORIDE is often used in research and pharmaceutical applications to study the effects of serotonin and its role in various physiological and psychological processes. Additionally, 5-HYDROXY-DL-TRYPTOPHAN ETHYL ESTER HYDROCHLORIDE may also have potential therapeutic applications in treating conditions related to serotonin imbalances, such as depression and anxiety disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 103404-89-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,4,0 and 4 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 103404-89:
(8*1)+(7*0)+(6*3)+(5*4)+(4*0)+(3*4)+(2*8)+(1*9)=83
83 % 10 = 3
So 103404-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2O3.ClH/c1-2-18-13(17)11(14)5-8-7-15-12-4-3-9(16)6-10(8)12;/h3-4,6-7,11,15-16H,2,5,14H2,1H3;1H/t11-;/m0./s1