104149-61-3 Usage
General Description
Methyl 4-acetyl-5-methylisoxazole-3-carboxylate is a synthetic compound that falls under the chemical class of Organic compounds known as isoxazoles. It is characterized by an isoxazole ring, which is a five-member unsaturated ring composed of one oxygen atom, one nitrogen atom, and three carbon atoms. The structural formula of this compound includes various substituents, including a methyl group and acetyl group at positions 4 and 5, and a carboxylate group on position 3. Its specific role or application is not widely documented, often indicating that it is primarily used or studied in relation to its chemical properties, reactions, or as a precursor for synthesizing other chemicals. Its physical properties, such as melting point, boiling point, solubility, toxicity, or environmental impact can vary depending on the specific conditions under which it is prepared or used.
Check Digit Verification of cas no
The CAS Registry Mumber 104149-61-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,1,4 and 9 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 104149-61:
(8*1)+(7*0)+(6*4)+(5*1)+(4*4)+(3*9)+(2*6)+(1*1)=93
93 % 10 = 3
So 104149-61-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO4/c1-4(10)6-5(2)13-9-7(6)8(11)12-3/h1-3H3
