104414-01-9 Usage
General Description
Dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-)]-iron is a chemical compound consisting of a porphyrin ligand coordinated to an iron ion. The compound has a tetramethyl-8,13-divinyl-2,18-porphinedipropionato(2-) moiety, with two propionate groups attached to the porphyrin ring. The iron ion is coordinated to the porphyrin through its nitrogen atoms, forming a stable complex. [dihydrogen 3,7,12,17-tetramethyl-8,13-divinyl-2,18-porphinedipropiona to(2-)]-iron has been studied for its potential applications in catalysis, bioinorganic chemistry, and medicinal chemistry due to its unique porphyrin structure and ability to facilitate redox reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 104414-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,4,1 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 104414-01:
(8*1)+(7*0)+(6*4)+(5*4)+(4*1)+(3*4)+(2*0)+(1*1)=69
69 % 10 = 9
So 104414-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-4/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;