104809-26-9 Usage
Description
HEXADECANOIC ACID 2-NITROPHENYL ESTER, also known as palmitic acid 2-nitrophenyl ester, is a chemical compound formed from the esterification of hexadecanoic acid with 2-nitrophenol. It is a white crystalline solid that is insoluble in water but soluble in organic solvents. HEXADECANOIC ACID 2-NITROPHENYL ESTER is known for its versatility in chemical synthesis and its potential applications in various fields.
Uses
Used in Pharmaceutical Synthesis:
HEXADECANOIC ACID 2-NITROPHENYL ESTER is used as a key intermediate in the synthesis of pharmaceuticals for its ability to facilitate the formation of complex organic molecules. Its reactivity and stability make it a valuable component in the development of new drugs.
Used in Organic Compound Synthesis:
In the field of organic chemistry, HEXADECANOIC ACID 2-NITROPHENYL ESTER is used as a reagent in various chemical reactions, contributing to the synthesis of a wide range of organic compounds. Its ester functionality allows for versatile reactions that can lead to the creation of new molecules with specific properties.
Used in Antimicrobial Applications:
HEXADECANOIC ACID 2-NITROPHENYL ESTER has been studied for its potential antimicrobial properties, making it a candidate for use in applications where the inhibition of microbial growth is necessary. This could include uses in healthcare, food preservation, and other industries where controlling microbial contamination is critical.
Used in Antioxidant Applications:
HEXADECANOIC ACID 2-NITROPHENYL ESTER has also been investigated for its antioxidant properties, which could make it useful in applications where protection against oxidative damage is required. This could be relevant in the food industry, cosmetics, and pharmaceuticals, where maintaining the stability and quality of products is essential.
Used in Chemical Research:
HEXADECANOIC ACID 2-NITROPHENYL ESTER is utilized as a research tool in chemical laboratories, where its unique properties can be explored for new reactions and applications. Its use in scientific research aids in the advancement of knowledge in organic chemistry and related fields.
Used in Industrial Applications:
In various industries, HEXADECANOIC ACID 2-NITROPHENYL ESTER may be employed for its specific chemical properties, such as in the development of new materials, coatings, or other products that require the unique characteristics of this ester compound. Its versatility and potential applications make it a valuable asset in industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 104809-26-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,4,8,0 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 104809-26:
(8*1)+(7*0)+(6*4)+(5*8)+(4*0)+(3*9)+(2*2)+(1*6)=109
109 % 10 = 9
So 104809-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-22(24)27-21-18-16-15-17-20(21)23(25)26/h15-18H,2-14,19H2,1H3