10502-21-3 Usage
Description
Hordatine B is a member of the benzofuran class, specifically a heterodimer of feruloylagmatine and para-coumarylagmatine. The hydroxy group of feruloylagmatine reacts with the ethene double bond of para-coumarylagmatine, resulting in oxidative coupling to form a furan ring. This unique structure gives Hordatine B its distinct properties and potential applications.
Uses
Used in Pharmaceutical Industry:
Hordatine B is used as a pharmaceutical compound for its potential therapeutic properties. The specific application reason is not provided in the materials, but given its structure and classification, it may have potential uses in the development of new drugs or treatments.
Used in Chemical Research:
Hordatine B can be used as a research compound in the field of chemistry, particularly in studying the properties and reactions of benzofuran derivatives. Its unique structure may provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Please note that the provided materials do not specify any particular applications for Hordatine B. The uses listed above are inferred based on its classification and structure. Further research and information would be required to determine its specific applications and potential benefits in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10502-21-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,5,0 and 2 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10502-21:
(7*1)+(6*0)+(5*5)+(4*0)+(3*2)+(2*2)+(1*1)=43
43 % 10 = 3
So 10502-21-3 is a valid CAS Registry Number.
InChI:InChI=1/C29H40N8O5/c1-41-22-17-18(6-11-23(39)34-12-2-4-14-36-28(30)31)16-21-24(27(40)35-13-3-5-15-37-29(32)33)25(42-26(21)22)19-7-9-20(38)10-8-19/h6-11,16-17,24-25,38H,2-5,12-15H2,1H3,(H,34,39)(H,35,40)(H4,30,31,36)(H4,32,33,37)/b11-6+/t24-,25+/m1/s1