109857-81-0 Usage
General Description
4-Bromo-1,1-Bis(3-Methyl-2-Thienyl)-1-Butene is a chemical compound that belongs to the class of organobromine compounds, specifically thiophenes. Thiophenes are aromatic compounds similar to benzene, but with one of the carbons replaced by a sulfur atom. In this compound, the thiophene rings are substituted with a methyl group and are connected to a bromine-substituted butene group. The exact properties of this compound, such as its physical/chemical properties, toxicity, and uses, are not widely documented in the public domain, suggesting that it could be a less common or specialized chemical compound. Such compounds often play a role in various scientific researches or are used in the synthesis of more complex molecules in the pharmaceutical or chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 109857-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,8,5 and 7 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 109857-81:
(8*1)+(7*0)+(6*9)+(5*8)+(4*5)+(3*7)+(2*8)+(1*1)=160
160 % 10 = 0
So 109857-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H15BrS2/c1-10-5-8-16-13(10)12(4-3-7-15)14-11(2)6-9-17-14/h4-6,8-9H,3,7H2,1-2H3