112089-31-3 Usage
Description
(S)-6-CHLORO-9-(1-PHENYLETHYL)-9H-PURINE is a chemical compound belonging to the purine class, which is a nitrogen-containing heterocyclic compound found in the structure of DNA and RNA. This specific compound features a chlorine atom and a phenylethyl group attached to the purine ring, giving it potential pharmaceutical properties. The "(S)" designation refers to the stereochemistry of the compound, which influences its biological activity and interactions with other molecules. It may be utilized in the development of drugs for various purposes, such as antiviral or antitumor agents.
Uses
Used in Pharmaceutical Industry:
(S)-6-CHLORO-9-(1-PHENYLETHYL)-9H-PURINE is used as a potential drug candidate for its potential antiviral and antitumor properties. (S)-6-CHLORO-9-(1-PHENYLETHYL)-9H-PURINE's unique structure and stereochemistry allow it to interact with biological targets, making it a promising candidate for further research and development in the pharmaceutical field.
Used in Research and Development:
In the field of scientific research, (S)-6-CHLORO-9-(1-PHENYLETHYL)-9H-PURINE serves as a valuable compound for studying the effects of stereochemistry on biological activity. Its potential applications in drug development make it an important subject for further investigation, as understanding its interactions with other molecules can lead to the creation of more effective treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 112089-31-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,0,8 and 9 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 112089-31:
(8*1)+(7*1)+(6*2)+(5*0)+(4*8)+(3*9)+(2*3)+(1*1)=93
93 % 10 = 3
So 112089-31-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11ClN4/c1-9(10-5-3-2-4-6-10)18-8-17-11-12(14)15-7-16-13(11)18/h2-9H,1H3/t9-/m0/s1
