115075-59-7 Usage
Description
b-D-Glucopyranuronic acid, 1-[a-methyl-4-(2-methylpropyl)benzeneacetate] is a complex organic compound with a unique chemical structure. It is a derivative of glucuronic acid, which is a sugar acid that is commonly found in the cell walls of plants and in the exoskeletons of some animals. The compound is characterized by its white solid appearance and is known for its potential applications in various fields, particularly in organic synthesis.
Uses
Used in Organic Synthesis:
b-D-Glucopyranuronic acid, 1-[a-methyl-4-(2-methylpropyl)benzeneacetate] is used as an intermediate in organic synthesis for the development of new compounds with potential applications in various industries. Its unique chemical structure allows for the creation of a wide range of products, including pharmaceuticals, agrochemicals, and materials for the chemical industry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, b-D-Glucopyranuronic acid, 1-[a-methyl-4-(2-methylpropyl)benzeneacetate] is used as a key component in the synthesis of Ibuprofen Acyl-β-D-glucuronide (mixture of diastereomers) (cas# 115075-59-7). b-D-Glucopyranuronic acid, 1-[a-methyl-4-(2-methylpropyl)benzeneacetate] is known for its potential therapeutic applications and is being explored for its use in the development of new drugs.
Used in Chemical Industry:
The compound is also utilized in the chemical industry for the production of various materials and products. Its unique properties make it a valuable component in the development of new materials with specific characteristics, such as improved stability, enhanced reactivity, or unique physical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 115075-59-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,0,7 and 5 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 115075-59:
(8*1)+(7*1)+(6*5)+(5*0)+(4*7)+(3*5)+(2*5)+(1*9)=107
107 % 10 = 7
So 115075-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H26O8/c1-9(2)8-11-4-6-12(7-5-11)10(3)18(25)27-19-15(22)13(20)14(21)16(26-19)17(23)24/h4-7,9-10,13-16,19-22H,8H2,1-3H3,(H,23,24)/t10?,13-,14-,15+,16-,19-/m0/s1