116889-64-6 Usage
General Description
1-Methyl-4-(5-tetrazolyl)-5-amino-1,2-pyrazole is a chemical compound with the molecular formula C7H8N8. It is a pyrazole derivative with a tetrazole ring attached to its 4th position and a methyl group at its first position. 1-Methyl-4-(5-tetrazolyl)-5-amino-1,2-pyrazole is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, due to its versatile chemical properties and medicinal potential. It is also known for its potential biological activities, including antimicrobial, antiviral, and anticancer properties, making it a promising candidate for further research and drug development. Additionally, it is used in the synthesis of various organic compounds and can serve as a building block for the development of new chemical entities with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 116889-64-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,6,8,8 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 116889-64:
(8*1)+(7*1)+(6*6)+(5*8)+(4*8)+(3*9)+(2*6)+(1*4)=166
166 % 10 = 6
So 116889-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N7/c1-12-4(6)3(2-7-12)5-8-10-11-9-5/h2H,6H2,1H3,(H,8,9,10,11)
