118337-33-0 Usage
General Description
2-BROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHAN-1-ONE is a chemical compound that belongs to the family of organic compounds known as benzothiophenes. It is specifically classified as a derivative of benzothiophene, a heterocyclic aromatic compound that contains a sulfur atom. 2-BROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHAN-1-ONE is characterized by the presence of a bromine atom, a chloro substituent, and a methyl group attached to the benzothiophene ring. It is also a form of ketone, a functional group that consists of a carbonyl group bonded to two carbon atoms. The chemical structure of 2-BROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHAN-1-ONE makes it a potential building block in the synthesis of various organic compounds and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 118337-33-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,3,3 and 7 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 118337-33:
(8*1)+(7*1)+(6*8)+(5*3)+(4*3)+(3*7)+(2*3)+(1*3)=120
120 % 10 = 0
So 118337-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3
