118736-08-6 Usage
Description
2-METHOXY-2-(2-NAPHTHYL)ACETONITRILE, with the CAS number 118736-08-6, is an organic compound that serves as a valuable intermediate in the synthesis of various organic molecules. Its unique chemical structure, featuring a methoxy and a nitrile group attached to a naphthyl moiety, makes it a versatile building block for creating a wide range of chemical products.
Uses
Used in Organic Synthesis:
2-METHOXY-2-(2-NAPHTHYL)ACETONITRILE is used as a synthetic intermediate for the production of various organic compounds. Its application in organic synthesis is due to its ability to undergo a range of chemical reactions, such as substitution, addition, and condensation, which can lead to the formation of diverse chemical products.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-METHOXY-2-(2-NAPHTHYL)ACETONITRILE is used as a key building block for the development of novel drug candidates. Its unique structure allows for the creation of new molecules with potential therapeutic properties, contributing to the discovery of innovative treatments for various diseases.
Used in Chemical Research:
2-METHOXY-2-(2-NAPHTHYL)ACETONITRILE is also utilized in chemical research as a model compound for studying various reaction mechanisms and exploring new synthetic routes. Its reactivity and structural features make it an ideal candidate for understanding the fundamental principles of organic chemistry and developing new methodologies for chemical synthesis.
Used in Material Science:
In the field of material science, 2-METHOXY-2-(2-NAPHTHYL)ACETONITRILE can be employed as a precursor for the development of advanced materials with specific properties, such as optoelectronic materials, polymers, and coatings. Its incorporation into these materials can lead to enhanced performance and novel applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 118736-08-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,7,3 and 6 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 118736-08:
(8*1)+(7*1)+(6*8)+(5*7)+(4*3)+(3*6)+(2*0)+(1*8)=136
136 % 10 = 6
So 118736-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO/c1-10(14-9-15)12-8-4-6-11-5-2-3-7-13(11)12/h2-8,10H,1H3/t10-/m0/s1
118736-08-6Relevant articles and documents
Design, synthesis and evaluation of novel P450 fluorescent probes bearing α-cyanoether
Zhang, Rong,Kang, Kyung-Don,Shan, Guomin,Hammock, Bruce D.
, p. 4331 - 4334 (2003)
Four α-cyano-containing ethers based on 2-alkoxy-2-naphthylacetonitriles have been designed as a novel structural class of cytochrome P450 fluorescent probes. Their syntheses, fluorescence properties and evaluation in the fluorogenic assay of cytochrome P
A Sterically Congested α-Cyanoamine as a Cyanating Reagent: Cyanation of Acetals and Orthoesters
Kotani, Shunsuke,Sakamoto, Midori,Osakama, Kazuki,Nakajima, Makoto
supporting information, p. 6606 - 6609 (2015/10/29)
The cyanation of acetals and orthoesters by using a sterically congested α-cyanoamine as a cyanating reagent was investigated. The α-cyanoamine effectively facilitated cyanation in the presence of trichlorosilyl triflate to produce a variety of cyanated adducts in excellent yields. Analysis of the reaction mixture by 1H NMR spectroscopy revealed that trichlorosilyl triflate produced an oxocarbenium cation species as an intermediate.