121191-53-5 Usage
Description
TEREPHTHALIC-CARBOXY-13C2 ACID, also known as Terephthalic Acid-alpha,alpha-13C2, is an isotopically labeled research compound with the chemical formula C8D2O3. It is characterized by the presence of two 13C isotopes in the alpha positions of the terephthalic acid molecule. This unique isotopic labeling allows for enhanced detection and tracking of the compound in various research applications.
Uses
Used in Chemical Research:
TEREPHTHALIC-CARBOXY-13C2 ACID is used as a research compound for studying chemical reactions and processes. The incorporation of 13C isotopes enables researchers to monitor the behavior of the compound in various chemical systems, providing valuable insights into reaction mechanisms and pathways.
Used in Analytical Chemistry:
In analytical chemistry, TEREPHTHALIC-CARBOXY-13C2 ACID serves as an internal standard or a reference compound for accurate quantification and identification of other related compounds. The distinct isotopic signature of the compound allows for precise measurements using techniques such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy.
Used in Environmental Studies:
TEREPHTHALIC-CARBOXY-13C2 ACID can be employed in environmental studies to trace the fate and transport of terephthalic acid and its derivatives in various ecosystems. The isotopic labeling aids in distinguishing the compound from naturally occurring terephthalic acid, enabling researchers to assess its impact on the environment and develop strategies for mitigation.
Used in Pharmaceutical Research:
In pharmaceutical research, TEREPHTHALIC-CARBOXY-13C2 ACID can be utilized to investigate the metabolism and pharmacokinetics of terephthalic acid and its analogs. The isotopic labeling allows for the tracking of the compound within biological systems, providing valuable information on its absorption, distribution, metabolism, and excretion.
Used in Material Science:
TEREPHTHALIC-CARBOXY-13C2 ACID can be incorporated into polymers and other materials to study their properties and behavior. The isotopic labeling can help researchers understand the molecular structure, dynamics, and interactions of the compound within the material, leading to the development of new materials with improved performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 121191-53-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,1,9 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 121191-53:
(8*1)+(7*2)+(6*1)+(5*1)+(4*9)+(3*1)+(2*5)+(1*3)=85
85 % 10 = 5
So 121191-53-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/i7+1,8+1
