1256794-24-7 Usage
General Description
4-Pyridazinecarboxylic acid, 6-chloro- is a chemical compound that belongs to the pyridine carboxylic acid family. It is a derivative of pyridazine and contains a carboxyl group at the 4th position and a chlorine atom at the 6th position. 4-Pyridazinecarboxylic acid, 6-chloro- has potential applications in the pharmaceutical industry, particularly in the development of drugs and medicinal products. Its chemical structure and properties make it a valuable intermediate for the synthesis of various pharmaceutical compounds and can be used as a building block for the creation of new drug candidates. Additionally, its chlorine substituent can also confer specific biological activities, making it an attractive molecule for medicinal chemistry research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 1256794-24-7 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,5,6,7,9 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1256794-24:
(9*1)+(8*2)+(7*5)+(6*6)+(5*7)+(4*9)+(3*4)+(2*2)+(1*4)=187
187 % 10 = 7
So 1256794-24-7 is a valid CAS Registry Number.
InChI:InChI=1S/C5H3ClN2O2/c6-4-1-3(5(9)10)2-7-8-4/h1-2H,(H,9,10)
1256794-24-7Relevant articles and documents
PIPERIDINE AND AZEPINE DERIVATIVES AS PROKINETICIN RECEPTOR MODULATORS
-
Page/Page column 59, (2015/02/25)
The present invention provides compounds of formula (I) and pharmaceutically acceptable salts thereof (Formula (I)) in which m, X, R1, R2, R3 and R5 are as defined in the specification, processes for their preparation, pharmaceutical compositions containing them and their use in therapy.