127420-27-3 Usage
General Description
The chemical "(1S,4S)-2-METHYL-2,5-DIAZABICYCLO(2.2.1)HEPTANE 2HBR" is a compound that consists of a bicyclic structure with a diaza-substituted ring. The chemical also contains a 2-methyl substituent, and is a derivative of the bicyclic compound 2,5-diazabicyclo[2.2.1]heptane. Additionally, the compound is in the form of a hydrobromide salt. This chemical may have various applications in chemistry and pharmacology due to its unique structure and potential for diverse reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 127420-27-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,7,4,2 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 127420-27:
(8*1)+(7*2)+(6*7)+(5*4)+(4*2)+(3*0)+(2*2)+(1*7)=103
103 % 10 = 3
So 127420-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2.2BrH/c1-8-4-5-2-6(8)3-7-5;;/h5-7H,2-4H2,1H3;2*1H/t5-,6-;;/m0../s1
127420-27-3Relevant articles and documents
Synthesis of substituted 2,5-diazabicyclo[2.2.1]heptanes
Yakovlev,Lobanov,Potekhin
, p. 429 - 431 (2007/10/03)
A new method is proposed for the synthesis of substituted 2,5-diazabicyclo[2.2.1]heptanes from 1-(tertbutoxycarbonyl)-4-tosyloxy-2-(tosyloxymethyl)pyrrolidine. 1H NMR spectroscopy indicated multiple conformations of 2-(tert-butoxycarbonyl)-2,5-