14192-26-8 Usage
Description
Methyl 2-oxoindole-6-carboxylate is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and bioactive molecules. It is characterized by its unique chemical structure, which includes an indole ring and a carboxylate group, making it a versatile building block in the development of new drugs and therapies.
Uses
Used in Pharmaceutical Industry:
Methyl 2-oxoindole-6-carboxylate is used as an intermediate for the synthesis of BIBF 1120, an indolinone triple angiokinase inhibitor. Methyl 2-oxoindole-6-carboxylate is significant in the development of targeted therapies for various types of cancer, as it can inhibit the activity of multiple angiokinases, which are enzymes involved in the formation of new blood vessels that supply tumors with nutrients and oxygen.
The use of Methyl 2-oxoindole-6-carboxylate in the pharmaceutical industry is primarily due to its role in the synthesis of BIBF 1120, which has shown potential in treating cancer by targeting angiogenesis, a process that is crucial for tumor growth and metastasis. By inhibiting angiokinases, BIBF 1120 can disrupt the blood supply to tumors, thereby limiting their growth and spread. This makes Methyl 2-oxoindole-6-carboxylate a valuable component in the development of novel cancer treatments and a promising candidate for further research and development in the pharmaceutical sector.
Check Digit Verification of cas no
The CAS Registry Mumber 14192-26-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,1,9 and 2 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 14192-26:
(7*1)+(6*4)+(5*1)+(4*9)+(3*2)+(2*2)+(1*6)=88
88 % 10 = 8
So 14192-26-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO3/c1-14-10(13)7-3-2-6-5-9(12)11-8(6)4-7/h2-4H,5H2,1H3,(H,11,12)
