141946-28-3 Usage
General Description
1,7-Bis(9-acridinyl)heptane is a synthetic organic compound belonging to the class of organic compounds known as acridines. These compounds are polycyclic aromatic compounds containing a three ring system with two benzene rings joined together by a pyridine ring. The chemical structure of 1,7-Bis(9-acridinyl)heptane is notable because it contains two acridine units linked through a seven-carbon chain. It is used in various medical and scientific studies due to its potential antitumor activities. However, detailed information about its properties such as its properties, safety, or specific applications can be limited as it is primarily researched rather than widely used or commercially available.
Check Digit Verification of cas no
The CAS Registry Mumber 141946-28-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,1,9,4 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 141946-28:
(8*1)+(7*4)+(6*1)+(5*9)+(4*4)+(3*6)+(2*2)+(1*8)=133
133 % 10 = 3
So 141946-28-3 is a valid CAS Registry Number.
InChI:InChI=1/C33H30N2/c1(2-4-14-24-26-16-6-10-20-30(26)34-31-21-11-7-17-27(24)31)3-5-15-25-28-18-8-12-22-32(28)35-33-23-13-9-19-29(25)33/h6-13,16-23H,1-5,14-15H2