143016-69-7 Usage
General Description
4-NITRO 3,5-DIMETHYL 2-HYDROXYMETHYL PYRIDINE.HCL is a chemical compound that consists of a pyridine core with a nitro group at the 4-position and methyl groups at the 3 and 5 positions. It also contains a hydroxymethyl group attached to the 2-position of the pyridine ring. The compound is in the form of a hydrochloride salt. It is commonly used in pharmaceutical and chemical synthesis as a building block or intermediate. 4-NITRO 3,5-DIMETHYL 2-HYDROXYMETHYL PYRIDINE.HCL may have potential applications in medicinal chemistry and drug development due to its unique structure and properties. For example, it might be used as a precursor in the synthesis of various pharmaceuticals with biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 143016-69-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,3,0,1 and 6 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 143016-69:
(8*1)+(7*4)+(6*3)+(5*0)+(4*1)+(3*6)+(2*6)+(1*9)=97
97 % 10 = 7
So 143016-69-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O3.ClH/c1-5-3-9-7(4-11)6(2)8(5)10(12)13;/h3,11H,4H2,1-2H3;1H
