145514-01-8 Usage
Description
(4-2-aminopurin-9-yl)-1,3-dioxolane-2-methanol is a chemical compound with the molecular formula C10H12N4O3. It features a purine base, which is a key component of DNA and RNA, along with a dioxolane ring and a methanol group. The purine base endows the compound with significant biological functions, such as acting as a precursor for the synthesis of nucleotides and nucleic acids. Additionally, the dioxolane ring and methanol group enhance the compound's solubility and stability in various solvents.
Uses
Used in Pharmaceutical Research and Development:
(4-2-aminopurin-9-yl)-1,3-dioxolane-2-methanol is utilized as a chemical intermediate in the synthesis of nucleotides and nucleic acids, which are essential for various biological processes. Its role in the development of new drugs and therapies is significant due to its potential to contribute to the understanding and treatment of genetic disorders and other diseases related to nucleic acid metabolism.
Used in Chemical Synthesis:
In the chemical synthesis industry, (4-2-aminopurin-9-yl)-1,3-dioxolane-2-methanol is used as a building block for the creation of more complex molecules. Its unique structure, which includes a purine base, dioxolane ring, and methanol group, allows it to be a versatile component in the synthesis of various pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Biochemical Research:
(4-2-aminopurin-9-yl)-1,3-dioxolane-2-methanol is employed as a research tool in biochemical studies. Its presence in DNA and RNA makes it a valuable compound for investigating the mechanisms of nucleic acid synthesis, replication, and repair. Furthermore, it can be used to study the interactions between nucleic acids and other biomolecules, providing insights into the fundamental processes of life.
Check Digit Verification of cas no
The CAS Registry Mumber 145514-01-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,5,1 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 145514-01:
(8*1)+(7*4)+(6*5)+(5*5)+(4*1)+(3*4)+(2*0)+(1*1)=108
108 % 10 = 8
So 145514-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H11N5O4/c10-9-12-7-6(8(16)13-9)11-3-14(7)4-2-17-5(1-15)18-4/h3-5,15H,1-2H2,(H3,10,12,13,16)/t4-,5-/m1/s1
145514-01-8Relevant articles and documents
Enantiomerically pure β-D-dioxolane-nucleosides
-
, (2008/06/13)
A method and composition for the treatment of humans infected with HIV that includes the administration of an HIV treatment amount of an enantiomerically pure β-D-dioxolanyl purine nucleoside of the formula: STR1 wherein R is OH, Cl, NH2, or H,
