146824-88-6 Usage
Description
1-(4-Fluorophenyl)-6-methyl-3-(2-quinolinylmethoxy)-4(1H)-pyridazinone is a complex chemical compound that belongs to the pyridazinone class of molecules. It features a fluorophenyl group, a methyl group, a quinolinylmethoxy group, and a pyridazinone ring, which collectively contribute to its potential pharmacological properties. Although the specific biological activities of this compound are not extensively documented, pyridazinones are known for their diverse therapeutic effects, such as anti-inflammatory, antimicrobial, and antiviral actions. This particular compound may hold promise in the field of drug discovery and development, targeting a range of diseases and conditions. Further research is essential to explore and confirm its potential applications and effects.
Uses
Used in Pharmaceutical Industry:
1-(4-Fluorophenyl)-6-methyl-3-(2-quinolinylmethoxy)-4(1H)-pyridazinone is used as a potential therapeutic agent for various diseases and conditions due to its pyridazinone derivative nature and the known pharmacological properties of similar compounds. Its potential applications may include the treatment of inflammatory conditions, microbial infections, and viral diseases.
Used in Drug Discovery and Development:
As a pyridazinone derivative, 1-(4-Fluorophenyl)-6-methyl-3-(2-quinolinylmethoxy)-4(1H)-pyridazinone is used in the research and development of new drugs. Its complex structure and the presence of multiple functional groups make it a candidate for further investigation into its pharmacological activities and potential therapeutic uses.
Used in Chemical Research:
1-(4-Fluorophenyl)-6-methyl-3-(2-quinolinylmethoxy)-4(1H)-pyridazinone is also utilized in chemical research to study the structure-activity relationships of pyridazinones and to understand how modifications to the molecular structure can influence its biological activities and potential applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 146824-88-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,6,8,2 and 4 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 146824-88:
(8*1)+(7*4)+(6*6)+(5*8)+(4*2)+(3*4)+(2*8)+(1*8)=156
156 % 10 = 6
So 146824-88-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H16FN3O2/c1-14-12-20(26)21(24-25(14)18-10-7-16(22)8-11-18)27-13-17-9-6-15-4-2-3-5-19(15)23-17/h2-12H,13H2,1H3