1478-37-1 Usage
Description
Omega-fluoro-9-octadecenoic acid, also known as (Z)-18-fluoro-9-octadecenoic acid, is a fluorofatty acid that can be found in the seed oil of Dichapetalum toxicarium. It is a unique compound due to the presence of a fluorine atom in its molecular structure, which may confer specific properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Omega-fluoro-9-octadecenoic acid is used as a pharmaceutical compound for its potential therapeutic applications. The presence of the fluorine atom may enhance the lipophilicity and membrane permeability of the molecule, making it a candidate for drug development, particularly in the treatment of certain diseases.
Used in Chemical Research:
In the field of chemical research, omega-fluoro-9-octadecenoic acid can be used as a starting material or a building block for the synthesis of more complex molecules with specific properties. Its unique structure may allow for the development of novel compounds with potential applications in various industries.
Used in Biochemical Studies:
Omega-fluoro-9-octadecenoic acid can be utilized in biochemical studies to investigate the effects of fluorination on the properties and functions of fatty acids. This may lead to a better understanding of the role of fluorinated compounds in biological systems and the development of new bioactive molecules.
Used in Industrial Applications:
The unique properties of omega-fluoro-9-octadecenoic acid may also find applications in various industrial processes, such as the production of specialty chemicals, materials, or lubricants. The fluorine atom could provide enhanced stability or performance characteristics in these applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1478-37-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,7 and 8 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1478-37:
(6*1)+(5*4)+(4*7)+(3*8)+(2*3)+(1*7)=91
91 % 10 = 1
So 1478-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H33FO2/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h1-2H,3-17H2,(H,20,21)/b2-1+
