148546-82-1 Usage
Description
4-Methylpyridine-3-boronic acid is an organic compound with the molecular formula C6H8BNO2. It is a derivative of pyridine, featuring a boronic acid group at the 3-position and a methyl group at the 4-position. 4-Methylpyridine-3-boronic acid is known for its chemical reactivity and is commonly utilized in the synthesis of various organic molecules, particularly in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
4-Methylpyridine-3-boronic acid is used as a synthetic intermediate for the preparation of pyridopyrimidinone derivatives. These derivatives act as antagonists of the aryl hydrocarbon receptor (AHR), which play a crucial role in the regulation of various cellular processes and are implicated in several diseases. By targeting the AHR pathway, these pyridopyrimidinone derivatives have potential applications in the treatment of diseases such as cancer, autoimmune disorders, and inflammatory conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 148546-82-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,5,4 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 148546-82:
(8*1)+(7*4)+(6*8)+(5*5)+(4*4)+(3*6)+(2*8)+(1*2)=161
161 % 10 = 1
So 148546-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H8BNO2/c1-5-2-3-8-4-6(5)7(9)10/h2-4,9-10H,1H3
