148612-16-2 Usage
General Description
2-Acetamido-5-Chloro-4-Picoline is a chemical compound with the molecular formula C8H8ClNO. It is a derivative of picoline, which is a heterocyclic organic compound. The presence of an acetamido group and a chlorine atom in the molecule gives it unique properties and potential applications in various fields such as pharmaceuticals, agrochemicals, and materials science. Studies have shown that 2-Acetamido-5-Chloro-4-Picoline exhibits antimicrobial and insecticidal properties, making it a potential candidate for the development of new drugs and pesticides. Its structure and reactivity also make it useful in organic synthesis and as a building block for the development of new compounds with diverse properties and applications. Overall, 2-Acetamido-5-Chloro-4-Picoline is a versatile chemical with potential uses in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 148612-16-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,8,6,1 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 148612-16:
(8*1)+(7*4)+(6*8)+(5*6)+(4*1)+(3*2)+(2*1)+(1*6)=132
132 % 10 = 2
So 148612-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2O/c1-5-3-8(11-6(2)12)10-4-7(5)9/h3-4H,1-2H3,(H,10,11,12)
148612-16-2Relevant articles and documents
Method of producing 2-acyl amino 5-halogenopyridine compounds
-
, (2008/06/13)
A 2-amino-3-nitro-5-halogenopyridine is formed from a 2-acylaminopyridine by way of a 2-acylamino-5-halogenopyridine. The 2-acetamido-5-bromopyridine may be formed from the 2-acylaminopyridine by way of a 2-acylaminopyridinium-HBr3 salt.