153138-05-7 Usage
General Description
2-Methyl-Oxazole-5-Carbaldehyde is an organic compound that belongs to the group of oxazoles, which are heterocyclic compounds containing an oxygen atom and a nitrogen atom in a five-membered ring. It is known for its usage in various chemical reactions and syntheses. The presence of the oxazole ring makes it a versatile compound in organic chemistry due to its nitrogen and oxygen atoms which can react with various chemicals. Furthermore, the methyl and aldehyde groups attached to the ring add to its reactivity, allowing it to take part in a wide array of chemical transformations. Its physical and chemical properties vary based on conditions, such as temperature, the presence of other chemicals, and pH.
Check Digit Verification of cas no
The CAS Registry Mumber 153138-05-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,1,3 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 153138-05:
(8*1)+(7*5)+(6*3)+(5*1)+(4*3)+(3*8)+(2*0)+(1*5)=107
107 % 10 = 7
So 153138-05-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NO2/c1-4-6-2-5(3-7)8-4/h2-3H,1H3
