155271-53-7 Usage
Class of organic compound
Purine
Type of derivative
Purine derivative
Substituents
Diethylmethyl group, bromo-dimethoxyphenyl ethenyl-substituted side chain
Chemical properties
Unique chemical properties due to the presence of substituents
Biochemical and pharmacological activities
Known for its biochemical and pharmacological activities
Uses
Commonly used as a synthetic intermediate in the production of various drugs and pharmaceutical compounds
Therapeutic potential
Studied for its potential therapeutic effects in various diseases and disorders due to its unique chemical structure and biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 155271-53-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,2,7 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 155271-53:
(8*1)+(7*5)+(6*5)+(5*2)+(4*7)+(3*1)+(2*5)+(1*3)=127
127 % 10 = 7
So 155271-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H23BrN4O4/c1-6-24-18-17(19(26)25(7-2)20(24)27)23(3)16(22-18)9-8-12-10-14(28-4)15(29-5)11-13(12)21/h8-11H,6-7H2,1-5H3/b9-8+
155271-53-7Relevant articles and documents
Antidepressants
-
, (2008/06/13)
The present invention relates to an antidepressant containing as an active ingredient a xanthine derivative or a pharmaceutically acceptable salt thereof, the xanthine derivative being represented by Formula (I) : STR1 in which R1, R2, and R3 represent independently hydrogen, lower alkyl, lower alkenyl; R4 represents cycloalkyl, --(CH2)n --R5 (in which R5 represents substituted or unsubstituted aryl or a substituted or unsubstituted heterocyclic group; and n is an integer of 0 to 4), or STR2 (in which Y1 and Y2 represent independently hydrogen, halogen or lower alkyl; and Z represents substituted or unsubstituted aryl, STR3 (in which R6 represents hydrogen, hydroxy, lower alkyl, lower alkoxy, halogen, nitro, or amino; and m represents an integer of 1 to 3), or a substituted or unsubstituted heterocyclic group); and X1 and X2 represent independently O or S.