162558-52-3 Usage
Description
MQAE, also known as 1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium (bromide), is a fluorescent indicator dye that is utilized for measuring intracellular and extracellular chloride concentrations. It operates through a mechanism of diffusion-limited collisional quenching, with an absorption/emission maximum at 350/460 nm. This dye is particularly useful in various applications due to its ability to detect chloride ions effectively.
Uses
Used in Chloride Transport Measurement:
MQAE is used as an improved chloride probe for measuring chloride transport in liposome membranes. This application is crucial in understanding the movement and regulation of chloride ions across cellular membranes, which is essential for various biological processes.
Used as a Fluorescent Chloride Indicator:
MQAE serves as a fluorescent chloride indicator, allowing researchers to monitor and analyze chloride ion concentrations in different environments. This is particularly useful in studying ion channels, transporters, and their role in cellular functions.
Used in Intracellular and Extracellular Chloride Concentration Measurement:
MQAE is used as a fluorescent indicator dye for measuring intracellular and extracellular chloride concentrations. Its ability to detect chloride ions via diffusion-limited collisional quenching makes it a valuable tool in research and diagnostics, particularly in the fields of cell biology, pharmacology, and physiology.
Check Digit Verification of cas no
The CAS Registry Mumber 162558-52-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,2,5,5 and 8 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 162558-52:
(8*1)+(7*6)+(6*2)+(5*5)+(4*5)+(3*8)+(2*5)+(1*2)=143
143 % 10 = 3
So 162558-52-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H16NO3.BrH/c1-3-18-14(16)10-15-8-4-5-11-9-12(17-2)6-7-13(11)15;/h4-9H,3,10H2,1-2H3;1H/q+1;/p-1
