16257-71-9 Usage
General Description
The chemical compound (2S,4R)-4-bromopyrrolidine-2-carboxylic acid is a derivative of pyrrolidine that contains a bromine atom and a carboxylic acid functional group. It is a chiral compound, meaning it has a non-superimposable mirror image, and the (2S,4R) notation indicates its stereochemistry. (2S,4R)-4-bromopyrrolidine-2-carboxylic acid has potential applications in the pharmaceutical industry, particularly in the development of new drugs or as a building block in organic synthesis. The presence of the bromine atom and carboxylic acid group gives this compound unique reactivity and properties, making it a valuable tool in chemical synthesis and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 16257-71-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,5 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 16257-71:
(7*1)+(6*6)+(5*2)+(4*5)+(3*7)+(2*7)+(1*1)=109
109 % 10 = 9
So 16257-71-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H8BrNO2/c6-3-1-4(5(8)9)7-2-3/h3-4,7H,1-2H2,(H,8,9)/t3-,4+/m1/s1
