16257-89-9 Usage
General Description
"(2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride" is a chemical compound that is primarily used in the field of organic chemistry and drug research. It is a dihydrochloride salt of an amino acid derivative known as 4-aminopyrrolidine-2-carboxylic acid, which has a specific stereochemistry denoted by the (2S,4R) configuration. (2S,4R)-4-aminopyrrolidine-2-carboxylic acid dihydrochloride has potential applications in the development of pharmaceuticals and as a building block in organic synthesis. Its properties and reactivity make it suitable for use in various chemical reactions and as a precursor for the synthesis of complex organic molecules. The dihydrochloride salt form of this compound enhances its solubility and stability, making it easier to handle and store in laboratory settings.
Check Digit Verification of cas no
The CAS Registry Mumber 16257-89-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,2,5 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16257-89:
(7*1)+(6*6)+(5*2)+(4*5)+(3*7)+(2*8)+(1*9)=119
119 % 10 = 9
So 16257-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O2.2ClH/c6-3-1-4(5(8)9)7-2-3;;/h3-4,7H,1-2,6H2,(H,8,9);2*1H/t3-,4+;;/m1../s1
