168153-00-2 Usage
Molecular structure
2-(hydroxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,5,7,9-tetrazabicyclo[4.3.0]nona-2,5,7-trien-4-one has a complex and long molecular structure.
Functional groups
The compound contains a hydroxymethyl group (-CH2OH), a tetrazol-5-yl group (-N4C=N-N=C=N-), and multiple phenyl groups (-Ph).
Bicyclic structure
The compound has a bicyclic structure with a tetrazabicyclo nona-2,5,7-trien-4-one backbone.
Pharmacological properties
2-(hydroxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,5,7,9-tetrazabicyclo[4.3.0]nona-2,5,7-trien-4-one is likely to exhibit various pharmacological properties, making it potentially useful in medicinal chemistry.
Synthesis challenges
Due to its complex molecular structure, the synthesis of this compound may be difficult and require advanced synthetic techniques.
Analysis and characterization
The intricate structure of the compound may also pose challenges in its analysis and characterization, necessitating the use of advanced analytical methods and instruments.
Potential applications
Given its complex structure and pharmacological properties, 2-(hydroxymethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,5,7,9-tetrazabicyclo[4.3.0]nona-2,5,7-trien-4-one may have potential applications in the field of medicinal chemistry, such as the development of new drugs or therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 168153-00-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,8,1,5 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 168153-00:
(8*1)+(7*6)+(6*8)+(5*1)+(4*5)+(3*3)+(2*0)+(1*0)=132
132 % 10 = 2
So 168153-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H16N8O2/c29-10-17-16(19(30)23-20-21-11-22-28(17)20)9-12-5-7-13(8-6-12)14-3-1-2-4-15(14)18-24-26-27-25-18/h1-8,11,29H,9-10H2,(H,21,22,23,30)(H,24,25,26,27)