17376-91-9 Usage
General Description
6,7-Diphenylpterin is a chemical compound with a molecular formula C20H14N4O2. It is a pterin derivative and plays a crucial role in the synthesis of tetrahydrobiopterin, which is an essential cofactor for several enzymes involved in neurotransmitter and nitric oxide production. 6,7-Diphenylpterin has been studied for its potential pharmacological applications, particularly in the treatment of neurological and cardiovascular disorders. Its ability to modulate the activity of key enzymes makes it a promising candidate for the development of new therapeutic interventions. Additionally, 6,7-Diphenylpterin has been investigated for its potential role in photodynamic therapy due to its light-absorbing properties. Further research into the pharmacological and therapeutic properties of 6,7-Diphenylpterin is warranted to explore its potential as a valuable compound in medicine and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 17376-91-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,7 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17376-91:
(7*1)+(6*7)+(5*3)+(4*7)+(3*6)+(2*9)+(1*1)=129
129 % 10 = 9
So 17376-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H13N5O/c19-18-22-16-15(17(24)23-18)20-13(11-7-3-1-4-8-11)14(21-16)12-9-5-2-6-10-12/h1-10H,(H3,19,21,22,23,24)