175204-06-5 Usage
General Description
2-Fluoro-6-phenoxybenzonitrile is a specific chemical compound with the molecular formula C13H8FNO. As its name suggests, it contains elements such as carbon, hydrogen, fluorine, nitrogen, and oxygen. Its structural formula is characterized by a phenyl ring bonded to an oxygen atom at the 6-position of a fluorobenzonitrile. As per the available data, details about its physical characteristics, medicinal or industrial usages, and safety measures seem limited. Further extensive research and studies are needed to identify the properties and potential applications of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-06-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175204-06:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*0)+(1*6)=115
115 % 10 = 5
So 175204-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H8FNO/c14-12-7-4-8-13(11(12)9-15)16-10-5-2-1-3-6-10/h1-8H