179555-11-4 Usage
General Description
2-Amino-4-methyl-5-pyridinecarboxylic acid is a chemical compound with the molecular formula C7H8N2O2. It is a derivative of pyridinecarboxylic acid and contains a pyridine ring with an amino group and a methyl group attached to it. 2-AMINO-4-METHYL-5-PYRIDINECARBOXYLIC ACID is commonly used as a building block in the synthesis of pharmaceuticals and agrochemicals. It is also used in the production of dyes and pigments. 2-Amino-4-methyl-5-pyridinecarboxylic acid is considered to be a versatile intermediate that plays a crucial role in the development of various chemical and pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 179555-11-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,5,5 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 179555-11:
(8*1)+(7*7)+(6*9)+(5*5)+(4*5)+(3*5)+(2*1)+(1*1)=174
174 % 10 = 4
So 179555-11-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c1-4-2-6(8)9-3-5(4)7(10)11/h2-3H,1H3,(H2,8,9)(H,10,11)