1822-31-7 Usage
Description
3-PIPERIDIN-3-YL-PROPIONIC ACID, also known as 3-(3-Piperidinyl)propanoic Acid, is an organic compound with the chemical formula C8H15NO2. It is a white crystalline solid and is soluble in water. 3-PIPERIDIN-3-YL-PROPIONIC ACID is a key intermediate in the synthesis of various pharmaceuticals and has potential applications in the development of new drugs.
Uses
Used in Pharmaceutical Industry:
3-PIPERIDIN-3-YL-PROPIONIC ACID is used as a reagent for synthesizing Truxillic Acid derivatives, which are important for studying the allosteric binding site of muscarinic acetylcholine receptors. These receptors play a crucial role in various physiological processes, including neurotransmission, heart rate regulation, and smooth muscle contraction. By targeting the allosteric binding site, Truxillic Acid derivatives can modulate the activity of these receptors, offering potential therapeutic benefits in the treatment of various diseases.
Additionally, 3-PIPERIDIN-3-YL-PROPIONIC ACID can be used as a building block in the synthesis of other bioactive compounds, such as analgesics, anti-inflammatory agents, and central nervous system modulators. Its versatile chemical structure allows for the development of new drugs with improved efficacy, safety, and pharmacokinetic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 1822-31-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,8,2 and 2 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1822-31:
(6*1)+(5*8)+(4*2)+(3*2)+(2*3)+(1*1)=67
67 % 10 = 7
So 1822-31-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h7,9H,1-6H2,(H,10,11)
