18344-58-6 Usage
Description
3,5-Dichloro-4-nitropyridine N-oxide is a chemical compound characterized by the molecular formula C5H2Cl2N3O3. It is a yellow to orange solid that is insoluble in water and has a melting point between 135-137 degrees Celsius. 3,5-DICHLORO-4-NITROPYRIDINE N-OXIDE is known for its unique properties and reactivity, making it a valuable building block in the development of other chemical compounds.
Uses
Used in Pharmaceutical Industry:
3,5-Dichloro-4-nitropyridine N-oxide is used as an intermediate in the synthesis of pharmaceuticals. Its unique properties and reactivity contribute to the development of new drugs and medications.
Used in Agrochemical Industry:
In the agrochemical industry, 3,5-Dichloro-4-nitropyridine N-oxide serves as an intermediate in the production of agrochemicals. Its role in this sector is crucial for the development of effective and innovative agricultural products.
Used in Dye Industry:
3,5-Dichloro-4-nitropyridine N-oxide is also utilized as an intermediate in the synthesis of dyes. Its chemical structure plays a significant role in creating a wide range of colorants for various applications.
Used in Organic Synthesis:
3,5-DICHLORO-4-NITROPYRIDINE N-OXIDE has been studied for its potential use in organic synthesis, where it can act as a reagent or building block for the creation of more complex organic molecules.
Used as a Reagent in Chemical Reactions:
3,5-Dichloro-4-nitropyridine N-oxide is employed as a reagent in various chemical reactions, further highlighting its versatility and importance in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 18344-58-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,3,4 and 4 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 18344-58:
(7*1)+(6*8)+(5*3)+(4*4)+(3*4)+(2*5)+(1*8)=116
116 % 10 = 6
So 18344-58-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H2Cl2N2O3/c6-3-1-8(10)2-4(7)5(3)9(11)12/h1-2H
