195202-08-5 Usage
Description
(S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID is an organic compound characterized by its unique molecular structure featuring a butyric acid backbone with a 3,4,5-trimethoxyphenyl group attached to the second carbon. (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID is known for its potential applications in various chemical syntheses and industries due to its versatile chemical properties.
Uses
Used in Chemical Synthesis:
(S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID is used as a building block for various chemical synthesis processes. Its unique structure allows it to be a key component in the creation of more complex molecules and compounds, which can be utilized in different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID is used as an intermediate in the synthesis of various drugs and medicinal compounds. Its specific functional groups and structural features make it a valuable asset in the development of new pharmaceuticals with potential therapeutic applications.
Used in Material Science:
(S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID can also be employed in the field of material science, where it may contribute to the development of novel materials with specific properties. Its incorporation into polymers or other materials could lead to advancements in areas such as electronics, coatings, or adhesives.
Used in Agricultural Industry:
Within the agricultural industry, (S)-2-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID may find use as a component in the development of new pesticides, herbicides, or other agrochemicals. Its unique structure could potentially enhance the effectiveness of these products or reduce their environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 195202-08-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,5,2,0 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 195202-08:
(8*1)+(7*9)+(6*5)+(5*2)+(4*0)+(3*2)+(2*0)+(1*8)=125
125 % 10 = 5
So 195202-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O5/c1-5-9(13(14)15)8-6-10(16-2)12(18-4)11(7-8)17-3/h6-7,9H,5H2,1-4H3,(H,14,15)/t9-/m0/s1
195202-08-5Relevant articles and documents
Synthetic process of homodimer of FKBP ligand
-
Paragraph 0030; 0044-0046, (2019/05/28)
The invention discloses a synthesis process of homodimer of FKBP ligand and belongs to an improved synthesis process of AP1903, wherein the homodimer of FKBP ligand refers to AP1903. According to theoptimized route of the synthesis process chooses, (S)-piperidine-2-methyl formate is connected to the compound Cpd9' as selected, an acid Cpd6' obtained after ester hydrolysis is easier to be purified by post-treatment purification, and precipitation or extraction treatment can be chosen by the post-treatment purification. Although the total reaction steps of the synthetic route in the prior literature are the same as the optimized route of the invention, the synthetic route in the prior literature belongs to the vertical route, and the post-treatment of the fifth, sixth and eighth steps requires column chromatography, thereby leading to a higher research and development cost. The optimized AP1903 synthetic route belongs to the parallel route, and the post-treatment is simpler and more advantageous for separation and purification, so that the cost of research and development is relatively low and the economic benefit is obviously superior to that of the synthetic route in the prior art.
METHODS AND COMPOSITIONS FOR THE SYNTHESIS OF MULTIMERIZING AGENTS
-
, (2012/08/08)
The invention features methods and compositions for the synthesis of multimerizing agents.
Synthetic multimerizing agents
-
, (2008/06/13)
New compounds are disclosed for multimerizing immunophilins and proteins containing immunophilin or immunophilin-related domains. The compounds are of the formulaM-L-Qwhere M is a synthetic ligand for an FKBP protein