19713-89-4 Usage
General Description
3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde, also known as CAS No.54624-96-1, is a specialized chemical compound. 3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde falls into the class of pyrroles, which are heterocyclic aromatic organic compounds composed of four carbon atoms and one nitrogen atom in a five-membered ring. Its molecular formula is C7H9NO. It's typically used in various synthetic applications within the chemical industry. The characteristics of 3,4-Dimethyl-1H-pyrrole-2-carboxaldehyde, including its chemical behaviors, reactivity, and potential health or safety hazards, are determined by its specific molecular structure. This chemical can be handled and stored in tightly sealed containers, away from heat and light sources.
Check Digit Verification of cas no
The CAS Registry Mumber 19713-89-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,1 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 19713-89:
(7*1)+(6*9)+(5*7)+(4*1)+(3*3)+(2*8)+(1*9)=134
134 % 10 = 4
So 19713-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO/c1-5-3-8-7(4-9)6(5)2/h3-4,8H,1-2H3