2005-98-3 Usage
General Description
1-(4-Amino-2-oxo-1(2H)-pyrimidinyl)-4-[[[(4S)-1,4,5,6-tetrahydro-2-amino-1-methylpyrimidin-4-yl]acetyl]amino]-1,2,3,4-tetradeoxy-β-D-erythro-2-hexenopyranuronic acid is a complex chemical compound with various functional groups, including an amino group, oxo group, and pyrimidinyl ring. It also contains a tetrahydro-2-amino-1-methylpyrimidin-4-yl group and a tetradeoxy-β-D-erythro-2-hexenopyranuronic acid moiety. This chemical is a derivative of pyrimidine and contains acetyl and amino groups, making it important in biological and pharmaceutical applications. Its structural complexity and diversity of functional groups make it a unique and potentially valuable molecule for medicinal research and therapeutic development.
Check Digit Verification of cas no
The CAS Registry Mumber 2005-98-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,0 and 5 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 2005-98:
(6*2)+(5*0)+(4*0)+(3*5)+(2*9)+(1*8)=53
53 % 10 = 3
So 2005-98-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H23N7O5/c1-23-6-4-9(20-16(23)19)8-12(25)21-10-2-3-13(29-14(10)15(26)27)24-7-5-11(18)22-17(24)28/h2-3,5,7,9-10,13-14H,4,6,8H2,1H3,(H2,19,20)(H,21,25)(H,26,27)(H2,18,22,28)/t9?,10-,13+,14-/m0/s1