20171-06-6 Usage
Chemical class
Anthracene derivatives
Structure
Consists of a butylamine group, a dihydroanthracene core, and a carboxamide functional group
Substituent
Contains a methylamino substituent
Molecular complexity
Highly specialized and unique molecule
Potential applications
Pharmaceuticals, dyes, and organic synthesis
Research status
Further research needed to understand properties and potential uses fully
Check Digit Verification of cas no
The CAS Registry Mumber 20171-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,1,7 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 20171-06:
(7*2)+(6*0)+(5*1)+(4*7)+(3*1)+(2*0)+(1*6)=56
56 % 10 = 6
So 20171-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N3O3/c1-3-4-9-23-20(26)13-10-14(22-2)15-16(17(13)21)19(25)12-8-6-5-7-11(12)18(15)24/h5-8,10,22H,3-4,9,21H2,1-2H3,(H,23,26)