202066-14-6 Usage
Description
1-METHYL-4-NITRO-3-PROPYL-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER is a synthetic chemical compound with the molecular formula C11H14N4O4. It is a nitropropiolate derivative that is commonly used in the synthesis of pharmaceuticals and agrochemicals. This chemical is known for its potential insecticidal properties and is used as an intermediate in the production of various pesticides. It is also used in laboratory research as a reagent or building block for the synthesis of other organic compounds. Additionally, its ester form suggests that it can be readily dissolved in organic solvents, making it versatile for use in various chemical reactions and applications.
Uses
Used in Pharmaceutical Industry:
1-METHYL-4-NITRO-3-PROPYL-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER is used as an intermediate in the synthesis of pharmaceuticals for its potential insecticidal properties and versatility in chemical reactions.
Used in Agrochemical Industry:
1-METHYL-4-NITRO-3-PROPYL-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER is used as an intermediate in the production of various pesticides due to its potential insecticidal properties.
Used in Laboratory Research:
1-METHYL-4-NITRO-3-PROPYL-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER is used as a reagent or building block for the synthesis of other organic compounds, taking advantage of its ester form for solubility in organic solvents and its ability to participate in various chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 202066-14-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,0,6 and 6 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 202066-14:
(8*2)+(7*0)+(6*2)+(5*0)+(4*6)+(3*6)+(2*1)+(1*4)=76
76 % 10 = 6
So 202066-14-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O4/c1-4-6-7-8(13(15)16)9(12(3)11-7)10(14)17-5-2/h4-6H2,1-3H3
