2052-75-7 Usage
General Description
(Z)-2,3-bis[4-(2-diethylaminoethoxy)phenyl]prop-2-enenitrile is a chemical compound consisting of two phenyl rings with diethylaminoethoxy groups attached to them, and a prop-2-enenitrile functional group. (Z)-2,3-bis[4-(2-diethylaminoethoxy)phenyl]prop-2-enenitrile is classified as a nitrile, and it is commonly used in the field of organic synthesis. It is also known for its potential applications in materials science and pharmaceutical research. Additionally, it possesses interesting properties that make it a valuable building block in the development of various functional materials and bioactive molecules. However, given its complex structure, (Z)-2,3-bis[4-(2-diethylaminoethoxy)phenyl]prop-2-enenitrile requires careful handling and expertise in its handling and usage.
Check Digit Verification of cas no
The CAS Registry Mumber 2052-75-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,5 and 2 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2052-75:
(6*2)+(5*0)+(4*5)+(3*2)+(2*7)+(1*5)=57
57 % 10 = 7
So 2052-75-7 is a valid CAS Registry Number.
InChI:InChI=1/C27H37N3O2/c1-5-29(6-2)17-19-31-26-13-9-23(10-14-26)21-25(22-28)24-11-15-27(16-12-24)32-20-18-30(7-3)8-4/h9-16,21H,5-8,17-20H2,1-4H3/b25-21+