215178-38-4 Usage
General Description
(S)-1-FMOC-3-Pyrrolidinol is a chemical compound that belongs to the class of pyrrolidinols. It is a derivative of pyrrolidine and is often used in the synthesis of various pharmaceuticals and chemical products. The compound is commonly utilized as a chiral building block in asymmetric synthesis, particularly in the production of drugs and agrochemicals. (S)-1-FMOC-3-Pyrrolidinol is known for its ability to act as a versatile intermediate in the creation of complex organic molecules, making it a valuable tool for chemical research and development. Due to its unique properties and potential applications, it is an important compound in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 215178-38-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,5,1,7 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 215178-38:
(8*2)+(7*1)+(6*5)+(5*1)+(4*7)+(3*8)+(2*3)+(1*8)=124
124 % 10 = 4
So 215178-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C19H19NO3/c21-13-9-10-20(11-13)19(22)23-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18,21H,9-12H2/t13-/m0/s1